C23H27FN2 — CID 169173689
N-ethyl-1-[(6R)-6-[(2-fluoro-3-phenylphenyl)methyl]-5-azaspiro[2.4]heptan-5-yl]ethenamine (PubChem CID 169173689) has the molecular formula C23H27FN2 and a molecular weight of 350.48 g/mol. Its IUPAC name is N-ethyl-1-[(6R)-6-[(2-fluoro-3-phenylphenyl)methyl]-5-azaspiro[2.4]heptan-5-yl]ethenamine.
| Compound Name | N-ethyl-1-[(6R)-6-[(2-fluoro-3-phenylphenyl)methyl]-5-azaspiro[2.4]heptan-5-yl]ethenamine |
|---|---|
| PubChem CID | 169173689 |
| Molecular Formula | C23H27FN2 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-ethyl-1-[(6R)-6-[(2-fluoro-3-phenylphenyl)methyl]-5-azaspiro[2.4]heptan-5-yl]ethenamine |
| SMILES | C=C(NCC)N1CC2(CC2)C[C@@H]1Cc1cccc(-c2ccccc2)c1F |
| InChI | InChI=1S/C23H27FN2/c1-3-25-17(2)26-16-23(12-13-23)15-20(26)14-19-10-7-11-21(22(19)24)18-8-5-4-6-9-18/h4-11,20,25H,2-3,12-16H2,1H3/t20-/m0/s1 |
| InChIKey | BTDBPXJOAKDRAO-FQEVSTJZSA-N |
| XLogP | 4.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |