C27H31F2NO — CID 169173707
(6R,7R)-6-[(2,5-difluoro-3-phenylphenyl)methyl]-N-ethyl-5-[1-[(2R)-oxetan-2-yl]ethenyl]spiro[2.4]heptan-7-amine (PubChem CID 169173707) has the molecular formula C27H31F2NO and a molecular weight of 423.55 g/mol. Its IUPAC name is (6R,7R)-6-[(2,5-difluoro-3-phenylphenyl)methyl]-N-ethyl-5-[1-[(2R)-oxetan-2-yl]ethenyl]spiro[2.4]heptan-7-amine.
| Compound Name | (6R,7R)-6-[(2,5-difluoro-3-phenylphenyl)methyl]-N-ethyl-5-[1-[(2R)-oxetan-2-yl]ethenyl]spiro[2.4]heptan-7-amine |
|---|---|
| PubChem CID | 169173707 |
| Molecular Formula | C27H31F2NO |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (6R,7R)-6-[(2,5-difluoro-3-phenylphenyl)methyl]-N-ethyl-5-[1-[(2R)-oxetan-2-yl]ethenyl]spiro[2.4]heptan-7-amine |
| SMILES | C=C(C1CC2(CC2)[C@H](NCC)[C@@H]1Cc1cc(F)cc(-c2ccccc2)c1F)[C@H]1CCO1 |
| InChI | InChI=1S/C27H31F2NO/c1-3-30-26-22(23(16-27(26)10-11-27)17(2)24-9-12-31-24)14-19-13-20(28)15-21(25(19)29)18-7-5-4-6-8-18/h4-8,13,15,22-24,26,30H,2-3,9-12,14,16H2,1H3/t22-,23?,24-,26-/m1/s1 |
| InChIKey | IDYVHNQUQKPLKG-QYFCNORHSA-N |
| XLogP | 5.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|