1-fluorocyclopropane-1-sulfinyl chloride

C3H4ClFOS — CID 169174082

IUPAC1-fluorocyclopropane-1-sulfinyl chloride
SMILESO=S(Cl)C1(F)CC1
InChIInChI=1S/C3H4ClFOS/c4-7(6)3(5)1-2-3/h1-2H2
InChIKeyZXWNKBRPPRDTGI-UHFFFAOYSA-N
MW142.58 g/mol
LogP1.35
Rot. Bonds1

About 1-fluorocyclopropane-1-sulfinyl chloride

1-fluorocyclopropane-1-sulfinyl chloride (PubChem CID 169174082) has the molecular formula C3H4ClFOS and a molecular weight of 142.58 g/mol. Its IUPAC name is 1-fluorocyclopropane-1-sulfinyl chloride.

Molecular Properties

Compound Name1-fluorocyclopropane-1-sulfinyl chloride
PubChem CID169174082
Molecular FormulaC3H4ClFOS
Molecular Weight142.58 g/mol
Exact Mass141.97
IUPAC Name1-fluorocyclopropane-1-sulfinyl chloride
SMILESO=S(Cl)C1(F)CC1
InChIInChI=1S/C3H4ClFOS/c4-7(6)3(5)1-2-3/h1-2H2
InChIKeyZXWNKBRPPRDTGI-UHFFFAOYSA-N
XLogP1.35
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.58
LogP ≤ 51.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze 1-fluorocyclopropane-1-sulfinyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-fluorocyclopropane-1-sulfinyl chloride?
The IUPAC name of 1-fluorocyclopropane-1-sulfinyl chloride (CID 169174082) is 1-fluorocyclopropane-1-sulfinyl chloride.
What is the SMILES notation for 1-fluorocyclopropane-1-sulfinyl chloride?
The canonical SMILES for 1-fluorocyclopropane-1-sulfinyl chloride is O=S(Cl)C1(F)CC1.
What is the InChIKey of 1-fluorocyclopropane-1-sulfinyl chloride?
The InChIKey is ZXWNKBRPPRDTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4ClFOS/c4-7(6)3(5)1-2-3/h1-2H2.
What are the key properties of 1-fluorocyclopropane-1-sulfinyl chloride?
1-fluorocyclopropane-1-sulfinyl chloride has a molecular weight of 142.58 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorocyclopropane-1-sulfinyl chloride is sourced from PubChem (CID 169174082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).