C24H33N6O4S- — CID 169174397
CID 169174397 (PubChem CID 169174397) has the molecular formula C24H33N6O4S- and a molecular weight of 501.63 g/mol.
| Compound Name | CID 169174397 |
|---|---|
| PubChem CID | 169174397 |
| Molecular Formula | C24H33N6O4S- |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | — |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(/[S-](=O)=N/C(=O)N(C(C)C)C(C)C)ccc3OCC)nc12 |
| InChI | InChI=1S/C24H33N6O4S/c1-8-10-18-20-21(29(7)27-18)23(31)26-22(25-20)17-13-16(11-12-19(17)34-9-2)35(33)28-24(32)30(14(3)4)15(5)6/h11-15H,8-10H2,1-7H3,(H,25,26,31)/q-1 |
| InChIKey | CLRHBRDKXKHZKK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|