C19H19N3O3 — CID 16917468
N-(5-benzyl-1,3,4-oxadiazol-2-yl)-2-(4-ethoxyphenyl)acetamide (PubChem CID 16917468) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-oxadiazol-2-yl)-2-(4-ethoxyphenyl)acetamide.
| Compound Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-2-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16917468 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-2-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(CC(=O)Nc2nnc(Cc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-24-16-10-8-15(9-11-16)12-17(23)20-19-22-21-18(25-19)13-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H,20,22,23) |
| InChIKey | HEJDHLPERNIXBC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |