About methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane
methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane (PubChem CID 169174711) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane.
Molecular Properties
| Compound Name | methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane |
| PubChem CID | 169174711 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane |
| SMILES | CCC.COC(=O)c1cc(N)cc(OC)c1O |
| InChI | InChI=1S/C9H11NO4.C3H8/c1-13-7-4-5(10)3-6(8(7)11)9(12)14-2;1-3-2/h3-4,11H,10H2,1-2H3;3H2,1-2H3 |
| InChIKey | POZVVGFXFYJEFJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane?
The IUPAC name of methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane (CID 169174711) is methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane.
What is the SMILES notation for methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane?
The canonical SMILES for methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane is CCC.COC(=O)c1cc(N)cc(OC)c1O.
What is the InChIKey of methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane?
The InChIKey is POZVVGFXFYJEFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4.C3H8/c1-13-7-4-5(10)3-6(8(7)11)9(12)14-2;1-3-2/h3-4,11H,10H2,1-2H3;3H2,1-2H3.
What are the key properties of methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane?
methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane has a molecular weight of 241.29 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-2-hydroxy-3-methoxybenzoate;propane is sourced from PubChem (CID 169174711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).