About (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate
(4-amino-2,6-dimethoxyphenyl) 2-bromoacetate (PubChem CID 169174746) has the molecular formula C10H12BrNO4
and a molecular weight of 290.11 g/mol. Its IUPAC name is (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate.
Molecular Properties
| Compound Name | (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate |
| PubChem CID | 169174746 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate |
| SMILES | COc1cc(N)cc(OC)c1OC(=O)CBr |
| InChI | InChI=1S/C10H12BrNO4/c1-14-7-3-6(12)4-8(15-2)10(7)16-9(13)5-11/h3-4H,5,12H2,1-2H3 |
| InChIKey | YSPBABQVQQDTEB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate?
The IUPAC name of (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate (CID 169174746) is (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate.
What is the SMILES notation for (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate?
The canonical SMILES for (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate is COc1cc(N)cc(OC)c1OC(=O)CBr.
What is the InChIKey of (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate?
The InChIKey is YSPBABQVQQDTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO4/c1-14-7-3-6(12)4-8(15-2)10(7)16-9(13)5-11/h3-4H,5,12H2,1-2H3.
What are the key properties of (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate?
(4-amino-2,6-dimethoxyphenyl) 2-bromoacetate has a molecular weight of 290.11 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2,6-dimethoxyphenyl) 2-bromoacetate is sourced from PubChem (CID 169174746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).