C28H24F2N6O — CID 169175449
4-[2-[[4-[2-(2-amino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methylamino]ethyl]-2-(difluoromethyl)benzaldehyde (PubChem CID 169175449) has the molecular formula C28H24F2N6O and a molecular weight of 498.54 g/mol. Its IUPAC name is 4-[2-[[4-[2-(2-amino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methylamino]ethyl]-2-(difluoromethyl)benzaldehyde.
| Compound Name | 4-[2-[[4-[2-(2-amino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methylamino]ethyl]-2-(difluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 169175449 |
| Molecular Formula | C28H24F2N6O |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 4-[2-[[4-[2-(2-amino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methylamino]ethyl]-2-(difluoromethyl)benzaldehyde |
| SMILES | Nc1ncccc1-c1nc2cccnc2n1-c1ccc(CNCCc2ccc(C=O)c(C(F)F)c2)cc1 |
| InChI | InChI=1S/C28H24F2N6O/c29-25(30)23-15-18(5-8-20(23)17-37)11-14-32-16-19-6-9-21(10-7-19)36-27(22-3-1-12-33-26(22)31)35-24-4-2-13-34-28(24)36/h1-10,12-13,15,17,25,32H,11,14,16H2,(H2,31,33) |
| InChIKey | YSCJFPKZEVPHRK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|