C28H24Cl2F3N3O2S — CID 169175799
6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfinyl)piperidin-4-yl]amino]quinolin-8-ol (PubChem CID 169175799) has the molecular formula C28H24Cl2F3N3O2S and a molecular weight of 594.49 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfinyl)piperidin-4-yl]amino]quinolin-8-ol.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfinyl)piperidin-4-yl]amino]quinolin-8-ol |
|---|---|
| PubChem CID | 169175799 |
| Molecular Formula | C28H24Cl2F3N3O2S |
| Molecular Weight | 594.49 g/mol |
| Exact Mass | 593.09 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfinyl)piperidin-4-yl]amino]quinolin-8-ol |
| SMILES | O=S(N1CCC(Nc2ccnc3c(O)cc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1)C(F)(F)F |
| InChI | InChI=1S/C28H24Cl2F3N3O2S/c29-20-5-1-17(2-6-20)26(18-3-7-21(30)8-4-18)19-15-23-24(9-12-34-27(23)25(37)16-19)35-22-10-13-36(14-11-22)39(38)28(31,32)33/h1-9,12,15-16,22,26,37H,10-11,13-14H2,(H,34,35) |
| InChIKey | WWFOGTHEDQUCEE-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.49 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|