About N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane
N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane (PubChem CID 169175927) has the molecular formula C16H15ClF2N2O
and a molecular weight of 324.76 g/mol. Its IUPAC name is N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane.
Molecular Properties
| Compound Name | N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane |
| PubChem CID | 169175927 |
| Molecular Formula | C16H15ClF2N2O |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane |
| SMILES | Cc1ccc(NC=O)cc1-c1ccc(Cl)cn1.FC1(F)CC1 |
| InChI | InChI=1S/C13H11ClN2O.C3H4F2/c1-9-2-4-11(16-8-17)6-12(9)13-5-3-10(14)7-15-13;4-3(5)1-2-3/h2-8H,1H3,(H,16,17);1-2H2 |
| InChIKey | CCEFIJUWMCSVTJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane?
The IUPAC name of N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane (CID 169175927) is N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane.
What is the SMILES notation for N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane?
The canonical SMILES for N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane is Cc1ccc(NC=O)cc1-c1ccc(Cl)cn1.FC1(F)CC1.
What is the InChIKey of N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane?
The InChIKey is CCEFIJUWMCSVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2O.C3H4F2/c1-9-2-4-11(16-8-17)6-12(9)13-5-3-10(14)7-15-13;4-3(5)1-2-3/h2-8H,1H3,(H,16,17);1-2H2.
What are the key properties of N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane?
N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane has a molecular weight of 324.76 g/mol, XLogP of 4.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(5-chloro-2-pyridinyl)-4-methylphenyl]formamide;1,1-difluorocyclopropane is sourced from PubChem (CID 169175927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).