C21H19FIN5O — CID 169176862
(2S)-N-[3-(5-fluoropyrimidin-2-yl)-4-methylphenyl]-3-iodo-1-pyridin-2-ylpyrrolidine-2-carboxamide (PubChem CID 169176862) has the molecular formula C21H19FIN5O and a molecular weight of 503.32 g/mol. Its IUPAC name is (2S)-N-[3-(5-fluoropyrimidin-2-yl)-4-methylphenyl]-3-iodo-1-pyridin-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-(5-fluoropyrimidin-2-yl)-4-methylphenyl]-3-iodo-1-pyridin-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169176862 |
| Molecular Formula | C21H19FIN5O |
| Molecular Weight | 503.32 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | (2S)-N-[3-(5-fluoropyrimidin-2-yl)-4-methylphenyl]-3-iodo-1-pyridin-2-ylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2C(I)CCN2c2ccccn2)cc1-c1ncc(F)cn1 |
| InChI | InChI=1S/C21H19FIN5O/c1-13-5-6-15(10-16(13)20-25-11-14(22)12-26-20)27-21(29)19-17(23)7-9-28(19)18-4-2-3-8-24-18/h2-6,8,10-12,17,19H,7,9H2,1H3,(H,27,29)/t17?,19-/m1/s1 |
| InChIKey | ALYOKEQVTFVHFF-WHCXFUJUSA-N |
| XLogP | 4.01 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|