C22H22F3N3O — CID 169177101
(3S,5S,8S)-N-(4-methyl-3-pyridin-2-ylphenyl)-7-(2,2,2-trifluoroethyl)-7-azatricyclo[3.2.1.01,3]octane-8-carboxamide (PubChem CID 169177101) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is (3S,5S,8S)-N-(4-methyl-3-pyridin-2-ylphenyl)-7-(2,2,2-trifluoroethyl)-7-azatricyclo[3.2.1.01,3]octane-8-carboxamide.
| Compound Name | (3S,5S,8S)-N-(4-methyl-3-pyridin-2-ylphenyl)-7-(2,2,2-trifluoroethyl)-7-azatricyclo[3.2.1.01,3]octane-8-carboxamide |
|---|---|
| PubChem CID | 169177101 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (3S,5S,8S)-N-(4-methyl-3-pyridin-2-ylphenyl)-7-(2,2,2-trifluoroethyl)-7-azatricyclo[3.2.1.01,3]octane-8-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2[C@@H]3C[C@H]4CC42N(CC(F)(F)F)C3)cc1-c1ccccn1 |
| InChI | InChI=1S/C22H22F3N3O/c1-13-5-6-16(9-17(13)18-4-2-3-7-26-18)27-20(29)19-14-8-15-10-21(15,19)28(11-14)12-22(23,24)25/h2-7,9,14-15,19H,8,10-12H2,1H3,(H,27,29)/t14-,15+,19-,21?/m1/s1 |
| InChIKey | LBKKQZDSZMQHJU-NMJBJHEPSA-N |
| XLogP | 4.27 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |