C9H21NO2S — CID 169177266
ethane;formic acid;3-propan-2-yl-1,3-thiazolidine (PubChem CID 169177266) has the molecular formula C9H21NO2S and a molecular weight of 207.34 g/mol. Its IUPAC name is ethane;formic acid;3-propan-2-yl-1,3-thiazolidine.
| Compound Name | ethane;formic acid;3-propan-2-yl-1,3-thiazolidine |
|---|---|
| PubChem CID | 169177266 |
| Molecular Formula | C9H21NO2S |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | ethane;formic acid;3-propan-2-yl-1,3-thiazolidine |
| SMILES | CC.CC(C)N1CCSC1.O=CO |
| InChI | InChI=1S/C6H13NS.C2H6.CH2O2/c1-6(2)7-3-4-8-5-7;1-2;2-1-3/h6H,3-5H2,1-2H3;1-2H3;1H,(H,2,3) |
| InChIKey | WDMJVVYHKNUKBV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|