About ethane;(1-ethylpiperidin-3-yl)methyl sulfamate
ethane;(1-ethylpiperidin-3-yl)methyl sulfamate (PubChem CID 169177383) has the molecular formula C10H24N2O3S
and a molecular weight of 252.38 g/mol. Its IUPAC name is ethane;(1-ethylpiperidin-3-yl)methyl sulfamate.
Molecular Properties
| Compound Name | ethane;(1-ethylpiperidin-3-yl)methyl sulfamate |
| PubChem CID | 169177383 |
| Molecular Formula | C10H24N2O3S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | ethane;(1-ethylpiperidin-3-yl)methyl sulfamate |
| SMILES | CC.CCN1CCCC(COS(N)(=O)=O)C1 |
| InChI | InChI=1S/C8H18N2O3S.C2H6/c1-2-10-5-3-4-8(6-10)7-13-14(9,11)12;1-2/h8H,2-7H2,1H3,(H2,9,11,12);1-2H3 |
| InChIKey | NHBFWJYMEAKUCR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;(1-ethylpiperidin-3-yl)methyl sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1-ethylpiperidin-3-yl)methyl sulfamate?
The IUPAC name of ethane;(1-ethylpiperidin-3-yl)methyl sulfamate (CID 169177383) is ethane;(1-ethylpiperidin-3-yl)methyl sulfamate.
What is the SMILES notation for ethane;(1-ethylpiperidin-3-yl)methyl sulfamate?
The canonical SMILES for ethane;(1-ethylpiperidin-3-yl)methyl sulfamate is CC.CCN1CCCC(COS(N)(=O)=O)C1.
What is the InChIKey of ethane;(1-ethylpiperidin-3-yl)methyl sulfamate?
The InChIKey is NHBFWJYMEAKUCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O3S.C2H6/c1-2-10-5-3-4-8(6-10)7-13-14(9,11)12;1-2/h8H,2-7H2,1H3,(H2,9,11,12);1-2H3.
What are the key properties of ethane;(1-ethylpiperidin-3-yl)methyl sulfamate?
ethane;(1-ethylpiperidin-3-yl)methyl sulfamate has a molecular weight of 252.38 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1-ethylpiperidin-3-yl)methyl sulfamate is sourced from PubChem (CID 169177383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).