C21H21Cl2N5O3 — CID 169177444
3-[[(6S)-5-[7,8-dichloro-4-(1,2,4-triazol-1-yl)quinolin-2-yl]-5-azaspiro[2.4]heptan-6-yl]methoxy]propanoic acid (PubChem CID 169177444) has the molecular formula C21H21Cl2N5O3 and a molecular weight of 462.34 g/mol. Its IUPAC name is 3-[[(6S)-5-[7,8-dichloro-4-(1,2,4-triazol-1-yl)quinolin-2-yl]-5-azaspiro[2.4]heptan-6-yl]methoxy]propanoic acid.
| Compound Name | 3-[[(6S)-5-[7,8-dichloro-4-(1,2,4-triazol-1-yl)quinolin-2-yl]-5-azaspiro[2.4]heptan-6-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 169177444 |
| Molecular Formula | C21H21Cl2N5O3 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 3-[[(6S)-5-[7,8-dichloro-4-(1,2,4-triazol-1-yl)quinolin-2-yl]-5-azaspiro[2.4]heptan-6-yl]methoxy]propanoic acid |
| SMILES | O=C(O)CCOC[C@@H]1CC2(CC2)CN1c1cc(-n2cncn2)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C21H21Cl2N5O3/c22-15-2-1-14-16(28-12-24-11-25-28)7-17(26-20(14)19(15)23)27-10-21(4-5-21)8-13(27)9-31-6-3-18(29)30/h1-2,7,11-13H,3-6,8-10H2,(H,29,30)/t13-/m0/s1 |
| InChIKey | SWMNGNCUMMPYBS-ZDUSSCGKSA-N |
| XLogP | 3.97 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|