About ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one
ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one (PubChem CID 169177659) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one |
| PubChem CID | 169177659 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one |
| SMILES | C=c1oc(=O)[nH]/c1=C/C(C)=C\CC.CC |
| InChI | InChI=1S/C10H13NO2.C2H6/c1-4-5-7(2)6-9-8(3)13-10(12)11-9;1-2/h5-6H,3-4H2,1-2H3,(H,11,12);1-2H3/b7-5-,9-6+; |
| InChIKey | GCYJBULNZNLEAB-UKRQJTKBSA-N |
| XLogP | 1.54 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one?
The IUPAC name of ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one (CID 169177659) is ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one.
What is the SMILES notation for ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one?
The canonical SMILES for ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one is C=c1oc(=O)[nH]/c1=C/C(C)=C\CC.CC.
What is the InChIKey of ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one?
The InChIKey is GCYJBULNZNLEAB-UKRQJTKBSA-N. The full InChI is InChI=1S/C10H13NO2.C2H6/c1-4-5-7(2)6-9-8(3)13-10(12)11-9;1-2/h5-6H,3-4H2,1-2H3,(H,11,12);1-2H3/b7-5-,9-6+;.
What are the key properties of ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one?
ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one has a molecular weight of 209.29 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4E)-5-methylidene-4-[(Z)-2-methylpent-2-enylidene]-1,3-oxazolidin-2-one is sourced from PubChem (CID 169177659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).