C23H33N3O3 — CID 169178686
[(3E)-4-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl] N-[(2E,5E,7E)-2,8-diamino-5,9-dimethyl-4-oxodeca-2,5,7,9-tetraen-3-yl]carbamate (PubChem CID 169178686) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is [(3E)-4-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl] N-[(2E,5E,7E)-2,8-diamino-5,9-dimethyl-4-oxodeca-2,5,7,9-tetraen-3-yl]carbamate.
| Compound Name | [(3E)-4-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl] N-[(2E,5E,7E)-2,8-diamino-5,9-dimethyl-4-oxodeca-2,5,7,9-tetraen-3-yl]carbamate |
|---|---|
| PubChem CID | 169178686 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | [(3E)-4-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl] N-[(2E,5E,7E)-2,8-diamino-5,9-dimethyl-4-oxodeca-2,5,7,9-tetraen-3-yl]carbamate |
| SMILES | C=C/C(C)=C(\C=C/C)C(C)OC(=O)N/C(C(=O)/C(C)=C/C=C(/N)C(=C)C)=C(\C)N |
| InChI | InChI=1S/C23H33N3O3/c1-9-11-19(15(5)10-2)18(8)29-23(28)26-21(17(7)24)22(27)16(6)12-13-20(25)14(3)4/h9-13,18H,2-3,24-25H2,1,4-8H3,(H,26,28)/b11-9-,16-12+,19-15+,20-13+,21-17+ |
| InChIKey | LJJROCQHYGKDSJ-ZAOYOQCBSA-N |
| XLogP | 4.30 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|