C14H18BrNO2 — CID 169178756
(2Z,4E,6E)-7-bromo-2-ethanimidoyl-3,4,8-trimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 169178756) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is (2Z,4E,6E)-7-bromo-2-ethanimidoyl-3,4,8-trimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2Z,4E,6E)-7-bromo-2-ethanimidoyl-3,4,8-trimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 169178756 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (2Z,4E,6E)-7-bromo-2-ethanimidoyl-3,4,8-trimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | [H]/N=C(C)/C(C(=O)O)=C(C)/C(C)=C/C=C(/Br)C(=C)C |
| InChI | InChI=1S/C14H18BrNO2/c1-8(2)12(15)7-6-9(3)10(4)13(11(5)16)14(17)18/h6-7,16H,1H2,2-5H3,(H,17,18)/b9-6+,12-7+,13-10-,16-11+ |
| InChIKey | QZJARHVAHIRVEA-OEZCFEODSA-N |
| XLogP | 4.23 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|