C24H24F2N6O8S — CID 169178876
2-[[3-[6-[3-[[bis(carboxymethyl)amino]methyl]-5-fluorosulfanylphenyl]-1,4-dihydro-1,2,4,5-tetrazin-3-yl]-5-fluorophenyl]methyl-(carboxymethyl)amino]acetic acid (PubChem CID 169178876) has the molecular formula C24H24F2N6O8S and a molecular weight of 594.55 g/mol. Its IUPAC name is 2-[[3-[6-[3-[[bis(carboxymethyl)amino]methyl]-5-fluorosulfanylphenyl]-1,4-dihydro-1,2,4,5-tetrazin-3-yl]-5-fluorophenyl]methyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[3-[6-[3-[[bis(carboxymethyl)amino]methyl]-5-fluorosulfanylphenyl]-1,4-dihydro-1,2,4,5-tetrazin-3-yl]-5-fluorophenyl]methyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 169178876 |
| Molecular Formula | C24H24F2N6O8S |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | 2-[[3-[6-[3-[[bis(carboxymethyl)amino]methyl]-5-fluorosulfanylphenyl]-1,4-dihydro-1,2,4,5-tetrazin-3-yl]-5-fluorophenyl]methyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1cc(F)cc(C2=NNC(c3cc(CN(CC(=O)O)CC(=O)O)cc(SF)c3)=NN2)c1 |
| InChI | InChI=1S/C24H24F2N6O8S/c25-17-3-13(7-31(9-19(33)34)10-20(35)36)1-15(5-17)23-27-29-24(30-28-23)16-2-14(4-18(6-16)41-26)8-32(11-21(37)38)12-22(39)40/h1-6H,7-12H2,(H,27,28)(H,29,30)(H,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | XPVKYGQHCCIAEW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 204.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |