About 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one
2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one (PubChem CID 169179056) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one |
| PubChem CID | 169179056 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one |
| SMILES | CCCC=CCC1C(C2=C(C)CCC2=O)C1(C)C |
| InChI | InChI=1S/C17H26O/c1-5-6-7-8-9-13-16(17(13,3)4)15-12(2)10-11-14(15)18/h7-8,13,16H,5-6,9-11H2,1-4H3 |
| InChIKey | YAQQRPREAQIQMI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one?
The IUPAC name of 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one (CID 169179056) is 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one.
What is the SMILES notation for 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one?
The canonical SMILES for 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one is CCCC=CCC1C(C2=C(C)CCC2=O)C1(C)C.
What is the InChIKey of 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one?
The InChIKey is YAQQRPREAQIQMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O/c1-5-6-7-8-9-13-16(17(13,3)4)15-12(2)10-11-14(15)18/h7-8,13,16H,5-6,9-11H2,1-4H3.
What are the key properties of 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one?
2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one has a molecular weight of 246.39 g/mol, XLogP of 4.68, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hex-2-enyl-2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one is sourced from PubChem (CID 169179056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).