C29H33N3O3 — CID 169179173
3,4-bis[4-(pyrrolidin-1-ylmethyl)phenoxy]benzamide (PubChem CID 169179173) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 3,4-bis[4-(pyrrolidin-1-ylmethyl)phenoxy]benzamide.
| Compound Name | 3,4-bis[4-(pyrrolidin-1-ylmethyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 169179173 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 3,4-bis[4-(pyrrolidin-1-ylmethyl)phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(CN3CCCC3)cc2)c(Oc2ccc(CN3CCCC3)cc2)c1 |
| InChI | InChI=1S/C29H33N3O3/c30-29(33)24-9-14-27(34-25-10-5-22(6-11-25)20-31-15-1-2-16-31)28(19-24)35-26-12-7-23(8-13-26)21-32-17-3-4-18-32/h5-14,19H,1-4,15-18,20-21H2,(H2,30,33) |
| InChIKey | NTWYGPHUPIHQMS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |