C14H16N4O2 — CID 169179205
N-[3-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]phenyl]formamide (PubChem CID 169179205) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-[3-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]phenyl]formamide.
| Compound Name | N-[3-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]phenyl]formamide |
|---|---|
| PubChem CID | 169179205 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-[3-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]phenyl]formamide |
| SMILES | Cn1cnnc1CC1(c2cccc(NC=O)c2)COC1 |
| InChI | InChI=1S/C14H16N4O2/c1-18-9-16-17-13(18)6-14(7-20-8-14)11-3-2-4-12(5-11)15-10-19/h2-5,9-10H,6-8H2,1H3,(H,15,19) |
| InChIKey | ZAQGPWJOHSNOSR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|