About 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide
6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide (PubChem CID 169179382) has the molecular formula C16H24N2O6
and a molecular weight of 340.38 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide.
Molecular Properties
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide |
| PubChem CID | 169179382 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide |
| SMILES | CCCC(=O)N(C=O)OC.O=CCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H13NO3.C6H11NO3/c12-8-4-2-1-3-7-11-9(13)5-6-10(11)14;1-3-4-6(9)7(5-8)10-2/h5-6,8H,1-4,7H2;5H,3-4H2,1-2H3 |
| InChIKey | ZHSSNKNLJHLREQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide?
The IUPAC name of 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide (CID 169179382) is 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide.
What is the SMILES notation for 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide?
The canonical SMILES for 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide is CCCC(=O)N(C=O)OC.O=CCCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide?
The InChIKey is ZHSSNKNLJHLREQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3.C6H11NO3/c12-8-4-2-1-3-7-11-9(13)5-6-10(11)14;1-3-4-6(9)7(5-8)10-2/h5-6,8H,1-4,7H2;5H,3-4H2,1-2H3.
What are the key properties of 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide?
6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide has a molecular weight of 340.38 g/mol, XLogP of 1.00, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dioxopyrrol-1-yl)hexanal;N-formyl-N-methoxybutanamide is sourced from PubChem (CID 169179382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).