C17H21BrF3NO2 — CID 169179659
methyl 2-(bromomethyl)-5-[[(3S)-3-methylpiperidin-1-yl]methyl]-3-(trifluoromethyl)benzoate (PubChem CID 169179659) has the molecular formula C17H21BrF3NO2 and a molecular weight of 408.26 g/mol. Its IUPAC name is methyl 2-(bromomethyl)-5-[[(3S)-3-methylpiperidin-1-yl]methyl]-3-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-(bromomethyl)-5-[[(3S)-3-methylpiperidin-1-yl]methyl]-3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 169179659 |
| Molecular Formula | C17H21BrF3NO2 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | methyl 2-(bromomethyl)-5-[[(3S)-3-methylpiperidin-1-yl]methyl]-3-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(CN2CCC[C@H](C)C2)cc(C(F)(F)F)c1CBr |
| InChI | InChI=1S/C17H21BrF3NO2/c1-11-4-3-5-22(9-11)10-12-6-13(16(23)24-2)14(8-18)15(7-12)17(19,20)21/h6-7,11H,3-5,8-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | MGLZFSGOSBXBLT-NSHDSACASA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|