C16H23N3O3S — CID 16917994
1-tert-butyl-3-[2-[(2-methyl-1H-indol-3-yl)sulfonyl]ethyl]urea (PubChem CID 16917994) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[(2-methyl-1H-indol-3-yl)sulfonyl]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[2-[(2-methyl-1H-indol-3-yl)sulfonyl]ethyl]urea |
|---|---|
| PubChem CID | 16917994 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-tert-butyl-3-[2-[(2-methyl-1H-indol-3-yl)sulfonyl]ethyl]urea |
| SMILES | Cc1[nH]c2ccccc2c1S(=O)(=O)CCNC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H23N3O3S/c1-11-14(12-7-5-6-8-13(12)18-11)23(21,22)10-9-17-15(20)19-16(2,3)4/h5-8,18H,9-10H2,1-4H3,(H2,17,19,20) |
| InChIKey | ZUZZGHLWACRGQE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |