C23H31N7O4 — CID 169179988
(2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-N-[(1R)-1-[4-(2-ethylpyrazol-3-yl)phenyl]-2-hydroxyethyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 169179988) has the molecular formula C23H31N7O4 and a molecular weight of 469.55 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-N-[(1R)-1-[4-(2-ethylpyrazol-3-yl)phenyl]-2-hydroxyethyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-N-[(1R)-1-[4-(2-ethylpyrazol-3-yl)phenyl]-2-hydroxyethyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169179988 |
| Molecular Formula | C23H31N7O4 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-N-[(1R)-1-[4-(2-ethylpyrazol-3-yl)phenyl]-2-hydroxyethyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CCn1nccc1-c1ccc([C@H](CO)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](N=[N+]=[N-])C(C)C)cc1 |
| InChI | InChI=1S/C23H31N7O4/c1-4-30-19(9-10-25-30)16-7-5-15(6-8-16)18(13-31)26-22(33)20-11-17(32)12-29(20)23(34)21(14(2)3)27-28-24/h5-10,14,17-18,20-21,31-32H,4,11-13H2,1-3H3,(H,26,33)/t17-,18+,20+,21+/m1/s1 |
| InChIKey | QUQYYFPQTPJAKY-ZFMNYDKASA-N |
| XLogP | 2.02 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|