C39H52BNO2 — CID 169180076
N-(4-tert-butylphenyl)-6,6,9,9,11,11-hexamethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydrobenzo[b]fluoren-2-amine (PubChem CID 169180076) has the molecular formula C39H52BNO2 and a molecular weight of 577.66 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-6,6,9,9,11,11-hexamethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydrobenzo[b]fluoren-2-amine.
| Compound Name | N-(4-tert-butylphenyl)-6,6,9,9,11,11-hexamethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydrobenzo[b]fluoren-2-amine |
|---|---|
| PubChem CID | 169180076 |
| Molecular Formula | C39H52BNO2 |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.41 |
| IUPAC Name | N-(4-tert-butylphenyl)-6,6,9,9,11,11-hexamethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydrobenzo[b]fluoren-2-amine |
| SMILES | CC(C)(C)c1ccc(Nc2cc3c(cc2B2OC(C)(C)C(C)(C)O2)-c2cc4c(cc2C3(C)C)C(C)(C)CCC4(C)C)cc1 |
| InChI | InChI=1S/C39H52BNO2/c1-34(2,3)24-14-16-25(17-15-24)41-33-23-29-27(21-32(33)40-42-38(10,11)39(12,13)43-40)26-20-30-31(22-28(26)37(29,8)9)36(6,7)19-18-35(30,4)5/h14-17,20-23,41H,18-19H2,1-13H3 |
| InChIKey | XGCTXFWRHCLMBB-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|