C24H25ClN2O3 — CID 169181051
3-[(3S)-7-chloro-3-cyclohexyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]propanoic acid (PubChem CID 169181051) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is 3-[(3S)-7-chloro-3-cyclohexyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]propanoic acid.
| Compound Name | 3-[(3S)-7-chloro-3-cyclohexyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 169181051 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 3-[(3S)-7-chloro-3-cyclohexyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)[C@H](C2CCCCC2)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H25ClN2O3/c25-18-11-12-20-19(15-18)22(16-7-3-1-4-8-16)26-23(17-9-5-2-6-10-17)24(30)27(20)14-13-21(28)29/h1,3-4,7-8,11-12,15,17,23H,2,5-6,9-10,13-14H2,(H,28,29)/t23-/m0/s1 |
| InChIKey | LLMRIOICKDXXAO-QHCPKHFHSA-N |
| XLogP | 4.95 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |