C11H26N2OPRf- — CID 169181228
carbamoylazanide;rutherfordium;2,3,3,5-tetramethylhexan-2-ylphosphane (PubChem CID 169181228) has the molecular formula C11H26N2OPRf- and a molecular weight of 500.32 g/mol. Its IUPAC name is carbamoylazanide;rutherfordium;2,3,3,5-tetramethylhexan-2-ylphosphane.
| Compound Name | carbamoylazanide;rutherfordium;2,3,3,5-tetramethylhexan-2-ylphosphane |
|---|---|
| PubChem CID | 169181228 |
| Molecular Formula | C11H26N2OPRf- |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | carbamoylazanide;rutherfordium;2,3,3,5-tetramethylhexan-2-ylphosphane |
| SMILES | CC(C)CC(C)(C)C(C)(C)P.[NH-]C(N)=O.[Rf] |
| InChI | InChI=1S/C10H23P.CH4N2O.Rf/c1-8(2)7-9(3,4)10(5,6)11;2-1(3)4;/h8H,7,11H2,1-6H3;(H4,2,3,4);/p-1 |
| InChIKey | QAGYSBVBVMGCDI-UHFFFAOYSA-M |
| XLogP | 3.83 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|