About 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane
2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane (PubChem CID 169181365) has the molecular formula C11H13N3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane.
Molecular Properties
| Compound Name | 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane |
| PubChem CID | 169181365 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane |
| SMILES | CC.Cc1ccnc2sc(N)c(C#N)c12 |
| InChI | InChI=1S/C9H7N3S.C2H6/c1-5-2-3-12-9-7(5)6(4-10)8(11)13-9;1-2/h2-3H,11H2,1H3;1-2H3 |
| InChIKey | RJMYDCNKZZODSK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane?
The IUPAC name of 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane (CID 169181365) is 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane.
What is the SMILES notation for 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane?
The canonical SMILES for 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane is CC.Cc1ccnc2sc(N)c(C#N)c12.
What is the InChIKey of 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane?
The InChIKey is RJMYDCNKZZODSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3S.C2H6/c1-5-2-3-12-9-7(5)6(4-10)8(11)13-9;1-2/h2-3H,11H2,1H3;1-2H3.
What are the key properties of 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane?
2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane has a molecular weight of 219.31 g/mol, XLogP of 3.08, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methylthieno[2,3-b]pyridine-3-carbonitrile;ethane is sourced from PubChem (CID 169181365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).