C22H35FN2O2 — CID 169181414
5-[[(6Z)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxymethyl]-6-methylidene-8-(propoxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine (PubChem CID 169181414) has the molecular formula C22H35FN2O2 and a molecular weight of 378.53 g/mol. Its IUPAC name is 5-[[(6Z)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxymethyl]-6-methylidene-8-(propoxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine.
| Compound Name | 5-[[(6Z)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxymethyl]-6-methylidene-8-(propoxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 169181414 |
| Molecular Formula | C22H35FN2O2 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 5-[[(6Z)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxymethyl]-6-methylidene-8-(propoxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine |
| SMILES | C=C1CC2(COCCC)CCCN2C1COCC12CCCN1C/C(=C\F)C2 |
| InChI | InChI=1S/C22H35FN2O2/c1-3-10-26-17-22-7-5-9-25(22)20(18(2)11-22)15-27-16-21-6-4-8-24(21)14-19(12-21)13-23/h13,20H,2-12,14-17H2,1H3/b19-13- |
| InChIKey | QMGUQYZOQNCTGG-UYRXBGFRSA-N |
| XLogP | 3.68 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|