About 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol
2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 169181655) has the molecular formula C7H10F2N2OS
and a molecular weight of 208.23 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol |
| PubChem CID | 169181655 |
| Molecular Formula | C7H10F2N2OS |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | OCC(NCC(F)F)c1cncs1 |
| InChI | InChI=1S/C7H10F2N2OS/c8-7(9)2-11-5(3-12)6-1-10-4-13-6/h1,4-5,7,11-12H,2-3H2 |
| InChIKey | CJAJOZOVUUABRR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol?
The IUPAC name of 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol (CID 169181655) is 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol.
What is the SMILES notation for 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol?
The canonical SMILES for 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol is OCC(NCC(F)F)c1cncs1.
What is the InChIKey of 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol?
The InChIKey is CJAJOZOVUUABRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2N2OS/c8-7(9)2-11-5(3-12)6-1-10-4-13-6/h1,4-5,7,11-12H,2-3H2.
What are the key properties of 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol?
2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol has a molecular weight of 208.23 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethylamino)-2-(1,3-thiazol-5-yl)ethanol is sourced from PubChem (CID 169181655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).