About (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+)
(4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+) (PubChem CID 169181657) has the molecular formula C9H18NRb
and a molecular weight of 225.72 g/mol. Its IUPAC name is (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+).
Molecular Properties
| Compound Name | (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+) |
| PubChem CID | 169181657 |
| Molecular Formula | C9H18NRb |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+) |
| SMILES | CCC1C[C@@H](C)CC(C)[N-]1.[Rb+] |
| InChI | InChI=1S/C9H18N.Rb/c1-4-9-6-7(2)5-8(3)10-9;/h7-9H,4-6H2,1-3H3;/q-1;+1/t7-,8?,9?;/m0./s1 |
| InChIKey | CHBPEPJQVIVEGU-OPLYHSBCSA-N |
| XLogP | -0.04 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+)?
The IUPAC name of (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+) (CID 169181657) is (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+).
What is the SMILES notation for (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+)?
The canonical SMILES for (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+) is CCC1C[C@@H](C)CC(C)[N-]1.[Rb+].
What is the InChIKey of (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+)?
The InChIKey is CHBPEPJQVIVEGU-OPLYHSBCSA-N. The full InChI is InChI=1S/C9H18N.Rb/c1-4-9-6-7(2)5-8(3)10-9;/h7-9H,4-6H2,1-3H3;/q-1;+1/t7-,8?,9?;/m0./s1.
What are the key properties of (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+)?
(4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+) has a molecular weight of 225.72 g/mol, XLogP of -0.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-ethyl-4,6-dimethylpiperidin-1-ide;rubidium(1+) is sourced from PubChem (CID 169181657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).