C12H19F2NO3 — CID 169181716
butyl (4S)-4-(2,2-difluoroethenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 169181716) has the molecular formula C12H19F2NO3 and a molecular weight of 263.28 g/mol. Its IUPAC name is butyl (4S)-4-(2,2-difluoroethenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | butyl (4S)-4-(2,2-difluoroethenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 169181716 |
| Molecular Formula | C12H19F2NO3 |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | butyl (4S)-4-(2,2-difluoroethenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCOC(=O)N1[C@@H](C=C(F)F)COC1(C)C |
| InChI | InChI=1S/C12H19F2NO3/c1-4-5-6-17-11(16)15-9(7-10(13)14)8-18-12(15,2)3/h7,9H,4-6,8H2,1-3H3/t9-/m0/s1 |
| InChIKey | QCWOJYTZXVNKFN-VIFPVBQESA-N |
| XLogP | 3.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|