About 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline
7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline (PubChem CID 169181849) has the molecular formula C9H4BrClF2N2S
and a molecular weight of 325.57 g/mol. Its IUPAC name is 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline.
Molecular Properties
| Compound Name | 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline |
| PubChem CID | 169181849 |
| Molecular Formula | C9H4BrClF2N2S |
| Molecular Weight | 325.57 g/mol |
| Exact Mass | 323.89 |
| IUPAC Name | 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline |
| SMILES | CSc1nc(Cl)c2c(F)cc(Br)c(F)c2n1 |
| InChI | InChI=1S/C9H4BrClF2N2S/c1-16-9-14-7-5(8(11)15-9)4(12)2-3(10)6(7)13/h2H,1H3 |
| InChIKey | RNAFCLYQLRYHPQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline?
The IUPAC name of 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline (CID 169181849) is 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline.
What is the SMILES notation for 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline?
The canonical SMILES for 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline is CSc1nc(Cl)c2c(F)cc(Br)c(F)c2n1.
What is the InChIKey of 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline?
The InChIKey is RNAFCLYQLRYHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrClF2N2S/c1-16-9-14-7-5(8(11)15-9)4(12)2-3(10)6(7)13/h2H,1H3.
What are the key properties of 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline?
7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline has a molecular weight of 325.57 g/mol, XLogP of 4.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-chloro-5,8-difluoro-2-methylsulfanylquinazoline is sourced from PubChem (CID 169181849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).