About 3-(difluoromethyl)-N,2-dimethylaniline;ethane
3-(difluoromethyl)-N,2-dimethylaniline;ethane (PubChem CID 169181895) has the molecular formula C11H17F2N
and a molecular weight of 201.26 g/mol. Its IUPAC name is 3-(difluoromethyl)-N,2-dimethylaniline;ethane.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-N,2-dimethylaniline;ethane |
| PubChem CID | 169181895 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-(difluoromethyl)-N,2-dimethylaniline;ethane |
| SMILES | CC.CNc1cccc(C(F)F)c1C |
| InChI | InChI=1S/C9H11F2N.C2H6/c1-6-7(9(10)11)4-3-5-8(6)12-2;1-2/h3-5,9,12H,1-2H3;1-2H3 |
| InChIKey | DMXNAIYKNKWOPK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(difluoromethyl)-N,2-dimethylaniline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-N,2-dimethylaniline;ethane?
The IUPAC name of 3-(difluoromethyl)-N,2-dimethylaniline;ethane (CID 169181895) is 3-(difluoromethyl)-N,2-dimethylaniline;ethane.
What is the SMILES notation for 3-(difluoromethyl)-N,2-dimethylaniline;ethane?
The canonical SMILES for 3-(difluoromethyl)-N,2-dimethylaniline;ethane is CC.CNc1cccc(C(F)F)c1C.
What is the InChIKey of 3-(difluoromethyl)-N,2-dimethylaniline;ethane?
The InChIKey is DMXNAIYKNKWOPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N.C2H6/c1-6-7(9(10)11)4-3-5-8(6)12-2;1-2/h3-5,9,12H,1-2H3;1-2H3.
What are the key properties of 3-(difluoromethyl)-N,2-dimethylaniline;ethane?
3-(difluoromethyl)-N,2-dimethylaniline;ethane has a molecular weight of 201.26 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-N,2-dimethylaniline;ethane is sourced from PubChem (CID 169181895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).