About butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine
butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine (PubChem CID 169182016) has the molecular formula C10H20FN
and a molecular weight of 173.27 g/mol. Its IUPAC name is butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine.
Molecular Properties
| Compound Name | butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine |
| PubChem CID | 169182016 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.27 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine |
| SMILES | CCCC.CN1CC/C(=C/F)C1 |
| InChI | InChI=1S/C6H10FN.C4H10/c1-8-3-2-6(4-7)5-8;1-3-4-2/h4H,2-3,5H2,1H3;3-4H2,1-2H3/b6-4-; |
| InChIKey | DDLXETXYYCQPKP-YHSAGPEESA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine?
The IUPAC name of butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine (CID 169182016) is butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine.
What is the SMILES notation for butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine?
The canonical SMILES for butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine is CCCC.CN1CC/C(=C/F)C1.
What is the InChIKey of butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine?
The InChIKey is DDLXETXYYCQPKP-YHSAGPEESA-N. The full InChI is InChI=1S/C6H10FN.C4H10/c1-8-3-2-6(4-7)5-8;1-3-4-2/h4H,2-3,5H2,1H3;3-4H2,1-2H3/b6-4-;.
What are the key properties of butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine?
butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine has a molecular weight of 173.27 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;(3Z)-3-(fluoromethylidene)-1-methylpyrrolidine is sourced from PubChem (CID 169182016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).