About 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane
1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane (PubChem CID 169182354) has the molecular formula C13H25F2N
and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane.
Molecular Properties
| Compound Name | 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane |
| PubChem CID | 169182354 |
| Molecular Formula | C13H25F2N |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane |
| SMILES | C=C(C(F)F)N1CCC(C(C)C)CC1.CC |
| InChI | InChI=1S/C11H19F2N.C2H6/c1-8(2)10-4-6-14(7-5-10)9(3)11(12)13;1-2/h8,10-11H,3-7H2,1-2H3;1-2H3 |
| InChIKey | BMSVUJJQXQNKLF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane?
The IUPAC name of 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane (CID 169182354) is 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane.
What is the SMILES notation for 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane?
The canonical SMILES for 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane is C=C(C(F)F)N1CCC(C(C)C)CC1.CC.
What is the InChIKey of 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane?
The InChIKey is BMSVUJJQXQNKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2N.C2H6/c1-8(2)10-4-6-14(7-5-10)9(3)11(12)13;1-2/h8,10-11H,3-7H2,1-2H3;1-2H3.
What are the key properties of 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane?
1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane has a molecular weight of 233.35 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoroprop-1-en-2-yl)-4-propan-2-ylpiperidine;ethane is sourced from PubChem (CID 169182354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).