About [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride
[1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride (PubChem CID 169182531) has the molecular formula C9H16F3NO
and a molecular weight of 211.23 g/mol. Its IUPAC name is [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride.
Molecular Properties
| Compound Name | [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride |
| PubChem CID | 169182531 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride |
| SMILES | F.OCC1(CN2CCC(F)(F)C2)CC1 |
| InChI | InChI=1S/C9H15F2NO.FH/c10-9(11)3-4-12(6-9)5-8(7-13)1-2-8;/h13H,1-7H2;1H |
| InChIKey | FWZYAWIOEIXCFS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride?
The IUPAC name of [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride (CID 169182531) is [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride.
What is the SMILES notation for [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride?
The canonical SMILES for [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride is F.OCC1(CN2CCC(F)(F)C2)CC1.
What is the InChIKey of [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride?
The InChIKey is FWZYAWIOEIXCFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO.FH/c10-9(11)3-4-12(6-9)5-8(7-13)1-2-8;/h13H,1-7H2;1H.
What are the key properties of [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride?
[1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride has a molecular weight of 211.23 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;hydrofluoride is sourced from PubChem (CID 169182531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).