C13H26N2O3 — CID 169182679
tert-butyl N-[1-[(3-hydroxypropylamino)methyl]cyclobutyl]carbamate (PubChem CID 169182679) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl N-[1-[(3-hydroxypropylamino)methyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[(3-hydroxypropylamino)methyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 169182679 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | tert-butyl N-[1-[(3-hydroxypropylamino)methyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(CNCCCO)CCC1 |
| InChI | InChI=1S/C13H26N2O3/c1-12(2,3)18-11(17)15-13(6-4-7-13)10-14-8-5-9-16/h14,16H,4-10H2,1-3H3,(H,15,17) |
| InChIKey | ZFPKCVYANHFNJC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|