C58H73F5N9O7Si — CID 169183459
CID 169183459 (PubChem CID 169183459) has the molecular formula C58H73F5N9O7Si and a molecular weight of 1131.35 g/mol.
| Compound Name | CID 169183459 |
|---|---|
| PubChem CID | 169183459 |
| Molecular Formula | C58H73F5N9O7Si |
| Molecular Weight | 1131.35 g/mol |
| Exact Mass | 1130.53 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CC[C@H](C(=O)N(C)[C@H](C(=O)NC([Si])[C@H]2Cc3cc(cc(C(F)F)c3)-c3ccc4c(c3)c(c(-c3cc(N5CCN(C)CC5)cnc3[C@H](C)OC)n4CC(F)(F)F)CC(C)(C)COC(=O)[C@@H]3CCCN(N3)C2=O)C(C)C)C1 |
| InChI | InChI=1S/C58H73F5N9O7Si/c1-10-47(73)70-17-15-37(30-70)54(75)68(8)49(33(2)3)52(74)65-53(80)43-24-35-22-38(25-39(23-35)51(59)60)36-13-14-46-41(26-36)44(28-57(5,6)32-79-56(77)45-12-11-16-72(66-45)55(43)76)50(71(46)31-58(61,62)63)42-27-40(29-64-48(42)34(4)78-9)69-20-18-67(7)19-21-69/h10,13-14,22-23,25-27,29,33-34,37,43,45,49,51,53,66H,1,11-12,15-21,24,28,30-32H2,2-9H3,(H,65,74)/t34-,37-,43+,45-,49-,53?/m0/s1 |
| InChIKey | CLBMDOVTDIRWGO-CRXJEDMMSA-N |
| XLogP | 7.24 |
| TPSA | 161.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1131.35 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|