C15H27NO5 — CID 169183620
ethyl 3-methoxy-3-[1-(3-methoxypropanoyl)pyrrolidin-2-yl]-2-methylpropanoate (PubChem CID 169183620) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is ethyl 3-methoxy-3-[1-(3-methoxypropanoyl)pyrrolidin-2-yl]-2-methylpropanoate.
| Compound Name | ethyl 3-methoxy-3-[1-(3-methoxypropanoyl)pyrrolidin-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 169183620 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | ethyl 3-methoxy-3-[1-(3-methoxypropanoyl)pyrrolidin-2-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)C(OC)C1CCCN1C(=O)CCOC |
| InChI | InChI=1S/C15H27NO5/c1-5-21-15(18)11(2)14(20-4)12-7-6-9-16(12)13(17)8-10-19-3/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | RUZZACQKCJYLBP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |