C31H46F3N5OS — CID 169183668
(Z,2Z)-2-butan-2-ylidene-7-methyl-6-[(E)-2-[2-[(1-methylsulfanylpiperidin-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]prop-1-enyl]imino-5-propan-2-ylidenenon-3-en-1-ol (PubChem CID 169183668) has the molecular formula C31H46F3N5OS and a molecular weight of 593.80 g/mol. Its IUPAC name is (Z,2Z)-2-butan-2-ylidene-7-methyl-6-[(E)-2-[2-[(1-methylsulfanylpiperidin-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]prop-1-enyl]imino-5-propan-2-ylidenenon-3-en-1-ol.
| Compound Name | (Z,2Z)-2-butan-2-ylidene-7-methyl-6-[(E)-2-[2-[(1-methylsulfanylpiperidin-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]prop-1-enyl]imino-5-propan-2-ylidenenon-3-en-1-ol |
|---|---|
| PubChem CID | 169183668 |
| Molecular Formula | C31H46F3N5OS |
| Molecular Weight | 593.80 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | (Z,2Z)-2-butan-2-ylidene-7-methyl-6-[(E)-2-[2-[(1-methylsulfanylpiperidin-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]prop-1-enyl]imino-5-propan-2-ylidenenon-3-en-1-ol |
| SMILES | CC/C(C)=C(/C=C\C(=C(C)C)/C(=N\C=C(/C)c1nc(NC2CCN(SC)CC2)ncc1C(F)(F)F)C(C)CC)CO |
| InChI | InChI=1S/C31H46F3N5OS/c1-9-21(5)24(19-40)11-12-26(20(3)4)28(22(6)10-2)35-17-23(7)29-27(31(32,33)34)18-36-30(38-29)37-25-13-15-39(41-8)16-14-25/h11-12,17-18,22,25,40H,9-10,13-16,19H2,1-8H3,(H,36,37,38)/b12-11-,23-17+,24-21-,35-28+ |
| InChIKey | LCRDVOOCXIXVCS-ITOHGXBPSA-N |
| XLogP | 8.11 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.80 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|