About CID 169184357
CID 169184357 (PubChem CID 169184357) has the molecular formula C10H19LrN2-
and a molecular weight of 429.28 g/mol.
Molecular Properties
| Compound Name | CID 169184357 |
| PubChem CID | 169184357 |
| Molecular Formula | C10H19LrN2- |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | — |
| SMILES | C[C-]1CN(N)CC2(CCCC2)C1.[Lr] |
| InChI | InChI=1S/C10H19N2.Lr/c1-9-6-10(4-2-3-5-10)8-12(11)7-9;/h2-8,11H2,1H3;/q-1; |
| InChIKey | MNVYFJPGZUYJLE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze CID 169184357 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169184357?
The IUPAC name of CID 169184357 (CID 169184357) is not available.
What is the SMILES notation for CID 169184357?
The canonical SMILES for CID 169184357 is C[C-]1CN(N)CC2(CCCC2)C1.[Lr].
What is the InChIKey of CID 169184357?
The InChIKey is MNVYFJPGZUYJLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N2.Lr/c1-9-6-10(4-2-3-5-10)8-12(11)7-9;/h2-8,11H2,1H3;/q-1;.
What are the key properties of CID 169184357?
CID 169184357 has a molecular weight of 429.28 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169184357 is sourced from PubChem (CID 169184357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).