About 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium
2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium (PubChem CID 169184463) has the molecular formula C10H21LrN2O-
and a molecular weight of 447.29 g/mol. Its IUPAC name is 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium.
Molecular Properties
| Compound Name | 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium |
| PubChem CID | 169184463 |
| Molecular Formula | C10H21LrN2O- |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium |
| SMILES | C[CH-]CC1(CCO)CCCN(N)C1.[Lr] |
| InChI | InChI=1S/C10H21N2O.Lr/c1-2-4-10(6-8-13)5-3-7-12(11)9-10;/h2,13H,3-9,11H2,1H3;/q-1; |
| InChIKey | HAGOUESVDAYCKX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium?
The IUPAC name of 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium (CID 169184463) is 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium.
What is the SMILES notation for 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium?
The canonical SMILES for 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium is C[CH-]CC1(CCO)CCCN(N)C1.[Lr].
What is the InChIKey of 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium?
The InChIKey is HAGOUESVDAYCKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N2O.Lr/c1-2-4-10(6-8-13)5-3-7-12(11)9-10;/h2,13H,3-9,11H2,1H3;/q-1;.
What are the key properties of 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium?
2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium has a molecular weight of 447.29 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-amino-3-propylpiperidin-3-yl)ethanol;lawrencium is sourced from PubChem (CID 169184463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).