C7H13FN2 — CID 169184754
(3R,3aS,6aS)-3-fluoro-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole (PubChem CID 169184754) has the molecular formula C7H13FN2 and a molecular weight of 144.19 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-fluoro-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole.
| Compound Name | (3R,3aS,6aS)-3-fluoro-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 169184754 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | (3R,3aS,6aS)-3-fluoro-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
| SMILES | CN1C[C@H](F)[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C7H13FN2/c1-10-4-6(8)5-2-9-3-7(5)10/h5-7,9H,2-4H2,1H3/t5-,6+,7-/m1/s1 |
| InChIKey | HYYHVDHYZOBLEZ-DSYKOEDSSA-N |
| XLogP | -0.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |