C32H29F3N4O2S — CID 169184761
4-[4-cyclopentylsulfanyl-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 169184761) has the molecular formula C32H29F3N4O2S and a molecular weight of 590.67 g/mol. Its IUPAC name is 4-[4-cyclopentylsulfanyl-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-cyclopentylsulfanyl-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 169184761 |
| Molecular Formula | C32H29F3N4O2S |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 4-[4-cyclopentylsulfanyl-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(SC5CCCC5)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C32H29F3N4O2S/c1-2-22-25(34)9-8-18-12-20(40)13-23(26(18)22)28-27(35)29-24(15-36-28)30(42-21-6-3-4-7-21)38-31(37-29)41-17-32-10-5-11-39(32)16-19(33)14-32/h1,8-9,12-13,15,19,21,40H,3-7,10-11,14,16-17H2/t19-,32+/m1/s1 |
| InChIKey | HBUHZBPLFICXEO-WHUARKNTSA-N |
| XLogP | 6.80 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|