About 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine
3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine (PubChem CID 169184809) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 169184809 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine |
| SMILES | COCc1nn(C)c2c1CCCN2C |
| InChI | InChI=1S/C10H17N3O/c1-12-6-4-5-8-9(7-14-3)11-13(2)10(8)12/h4-7H2,1-3H3 |
| InChIKey | PUAXXYLGFJDHFG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine (CID 169184809) is 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine is COCc1nn(C)c2c1CCCN2C.
What is the InChIKey of 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine?
The InChIKey is PUAXXYLGFJDHFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-12-6-4-5-8-9(7-14-3)11-13(2)10(8)12/h4-7H2,1-3H3.
What are the key properties of 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine?
3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine has a molecular weight of 195.27 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-1,7-dimethyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 169184809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).