C11H16O5S — CID 169185548
methyl 5-(2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)pentanoate (PubChem CID 169185548) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is methyl 5-(2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)pentanoate.
| Compound Name | methyl 5-(2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)pentanoate |
|---|---|
| PubChem CID | 169185548 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | methyl 5-(2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)pentanoate |
| SMILES | COC(=O)CCCCC1SCC2OC(=O)OC21 |
| InChI | InChI=1S/C11H16O5S/c1-14-9(12)5-3-2-4-8-10-7(6-17-8)15-11(13)16-10/h7-8,10H,2-6H2,1H3 |
| InChIKey | VYRULPHEAARBAK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|