C30H32ClN5O4 — CID 169185643
3-(3-chloro-2-methoxyanilino)-2-[6-(3-morpholin-4-ylpropoxy)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydroindol-4-one (PubChem CID 169185643) has the molecular formula C30H32ClN5O4 and a molecular weight of 562.07 g/mol. Its IUPAC name is 3-(3-chloro-2-methoxyanilino)-2-[6-(3-morpholin-4-ylpropoxy)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 3-(3-chloro-2-methoxyanilino)-2-[6-(3-morpholin-4-ylpropoxy)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 169185643 |
| Molecular Formula | C30H32ClN5O4 |
| Molecular Weight | 562.07 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | 3-(3-chloro-2-methoxyanilino)-2-[6-(3-morpholin-4-ylpropoxy)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydroindol-4-one |
| SMILES | COc1c(Cl)cccc1Nc1c(-c2ccnc3ccc(OCCCN4CCOCC4)nc23)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C30H32ClN5O4/c1-38-30-20(31)5-2-7-23(30)34-29-26-21(6-3-8-24(26)37)33-28(29)19-11-12-32-22-9-10-25(35-27(19)22)40-16-4-13-36-14-17-39-18-15-36/h2,5,7,9-12,33-34H,3-4,6,8,13-18H2,1H3 |
| InChIKey | LLDSXDIUECTDER-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.07 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|